What is the molecular formula of 4-Chlorophenethyl bromide?
The molecular formula of 4-Chlorophenethyl bromide is C8H8BrCl.
What are the synonyms for 4-Chlorophenethyl bromide?
The synonyms for 4-Chlorophenethyl bromide are 1-(2-BROMOETHYL)-4-CHLOROBENZENE, 6529-53-9, 4-Chlorophenethyl bromide, Benzene, 1-(2-bromoethyl)-4-chloro-, and 1-Bromo-2-(4-chlorophenyl)ethane.
What is the molecular weight of 4-Chlorophenethyl bromide?
The molecular weight of 4-Chlorophenethyl bromide is 219.50 g/mol.
What is the IUPAC name of 4-Chlorophenethyl bromide?
The IUPAC name of 4-Chlorophenethyl bromide is 1-(2-bromoethyl)-4-chlorobenzene.
What is the InChI of 4-Chlorophenethyl bromide?
The InChI of 4-Chlorophenethyl bromide is InChI=1S/C8H8BrCl/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2.
What is the InChIKey of 4-Chlorophenethyl bromide?
The InChIKey of 4-Chlorophenethyl bromide is YAFMYKFAUNCQPU-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chlorophenethyl bromide?
The canonical SMILES of 4-Chlorophenethyl bromide is C1=CC(=CC=C1CCBr)Cl.
What is the CAS number of 4-Chlorophenethyl bromide?
The CAS number of 4-Chlorophenethyl bromide is 6529-53-9.
Is 4-Chlorophenethyl bromide a canonicalized compound?
Yes, 4-Chlorophenethyl bromide is a canonicalized compound.
※ Please kindly note that our products are for research use only.