What is the molecular formula of 4-Chloroisophthalic acid?
The molecular formula of 4-Chloroisophthalic acid is C8H5ClO4.
What are some synonyms for 4-Chloroisophthalic acid?
Some synonyms for 4-Chloroisophthalic acid include 4-chlorobenzene-1,3-dicarboxylic acid and isophthalic acid, 4-chloro.
When was 4-Chloroisophthalic acid created in PubChem?
4-Chloroisophthalic acid was created in PubChem on March 26, 2005.
What is the molecular weight of 4-Chloroisophthalic acid?
The molecular weight of 4-Chloroisophthalic acid is 200.57 g/mol.
What is the Canonical SMILES for 4-Chloroisophthalic acid?
The Canonical SMILES for 4-Chloroisophthalic acid is C1=CC(=C(C=C1C(=O)O)C(=O)O)Cl.
How many Hydrogen Bond Donors does 4-Chloroisophthalic acid have?
4-Chloroisophthalic acid has 2 Hydrogen Bond Donors.
What is the exact mass of 4-Chloroisophthalic acid?
The exact mass of 4-Chloroisophthalic acid is 199.9876363 g/mol.
How many rotatable bonds does 4-Chloroisophthalic acid have?
4-Chloroisophthalic acid has 2 rotatable bonds.
What is the topological polar surface area of 4-Chloroisophthalic acid?
The topological polar surface area of 4-Chloroisophthalic acid is 74.6 Ų.
Is 4-Chloroisophthalic acid considered a canonicalized compound in PubChem?
Yes, 4-Chloroisophthalic acid is considered a canonicalized compound in PubChem.