What is the molecular formula of 4-Chloro-3-methylphenylboronic acid?
The molecular formula is C7H8BClO2.
What are the synonyms for 4-Chloro-3-methylphenylboronic acid?
The synonyms include 4-CHLORO-3-METHYLPHENYLBORONIC ACID, 161950-10-3, (4-chloro-3-methylphenyl)boronic acid, 4-Chloro-3-methylbenzeneboronic acid, and BORONIC ACID, B-(4-CHLORO-3-METHYLPHENYL)-.
What is the molecular weight of 4-Chloro-3-methylphenylboronic acid?
The molecular weight is 170.40 g/mol.
What is the IUPAC Name of 4-Chloro-3-methylphenylboronic acid?
The IUPAC Name is (4-chloro-3-methylphenyl)boronic acid.
What is the InChI of 4-Chloro-3-methylphenylboronic acid?
The InChI is InChI=1S/C7H8BClO2/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,10-11H,1H3.
What is the InChIKey of 4-Chloro-3-methylphenylboronic acid?
The InChIKey is UZDPQDBLCJDUAX-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloro-3-methylphenylboronic acid?
The canonical SMILES is B(C1=CC(=C(C=C1)Cl)C)(O)O.
What is the CAS number of 4-Chloro-3-methylphenylboronic acid?
The CAS number is 161950-10-3.
What is the EC number of 4-Chloro-3-methylphenylboronic acid?
The EC number is 681-357-5.
Is 4-Chloro-3-methylphenylboronic acid a canonicalized compound?
Yes, 4-Chloro-3-methylphenylboronic acid is a canonicalized compound.
※ Please kindly note that our products are for research use only.