What is the molecular formula of 4-Chloro-2-fluoroaniline?
The molecular formula of 4-Chloro-2-fluoroaniline is C6H5ClFN.
What is the molecular weight of 4-Chloro-2-fluoroaniline?
The molecular weight of 4-Chloro-2-fluoroaniline is 145.56 g/mol.
What is the IUPAC name of 4-Chloro-2-fluoroaniline?
The IUPAC name of 4-Chloro-2-fluoroaniline is 4-chloro-2-fluoroaniline.
What is the InChI of 4-Chloro-2-fluoroaniline?
The InChI of 4-Chloro-2-fluoroaniline is InChI=1S/C6H5ClFN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2.
What is the InChIKey of 4-Chloro-2-fluoroaniline?
The InChIKey of 4-Chloro-2-fluoroaniline is CSFDTBRRIBJILD-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloro-2-fluoroaniline?
The canonical SMILES of 4-Chloro-2-fluoroaniline is C1=CC(=C(C=C1Cl)F)N.
What is the CAS number of 4-Chloro-2-fluoroaniline?
The CAS number of 4-Chloro-2-fluoroaniline is 57946-56-2.
What is the European Community (EC) number of 4-Chloro-2-fluoroaniline?
The European Community (EC) number of 4-Chloro-2-fluoroaniline is 261-034-1.
What is the DSSTox Substance ID of 4-Chloro-2-fluoroaniline?
The DSSTox Substance ID of 4-Chloro-2-fluoroaniline is DTXSID00206666.
Is 4-Chloro-2-fluoroaniline a canonicalized compound?
Yes, 4-Chloro-2-fluoroaniline is a canonicalized compound.