In the experiment of drug synthesis, 4-Chloro-2-fluoro-3-methoxyphenylboronic acid can be used as raw material to obtain high-yield fluorine-containing drugs.
What is the molecular formula of 4-Chloro-2-fluoro-3-methoxyphenylboronic acid?
The molecular formula is C7H7BClFO3.
What is the molecular weight of 4-Chloro-2-fluoro-3-methoxyphenylboronic acid?
The molecular weight is 204.39 g/mol.
What is the IUPAC name of 4-Chloro-2-fluoro-3-methoxyphenylboronic acid?
The IUPAC name is (4-chloro-2-fluoro-3-methoxyphenyl)boronic acid.
What is the InChI of 4-Chloro-2-fluoro-3-methoxyphenylboronic acid?
The InChI is InChI=1S/C7H7BClFO3/c1-13-7-5(9)3-2-4(6(7)10)8(11)12/h2-3,11-12H,1H3.
What is the InChIKey of 4-Chloro-2-fluoro-3-methoxyphenylboronic acid?
The InChIKey is GDJCQSNQOHRAGY-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloro-2-fluoro-3-methoxyphenylboronic acid?
The canonical SMILES is B(C1=C(C(=C(C=C1)Cl)OC)F)(O)O.
What is the CAS number of 4-Chloro-2-fluoro-3-methoxyphenylboronic acid?
The CAS number is 944129-07-1.
What is the EC number of 4-Chloro-2-fluoro-3-methoxyphenylboronic acid?
The EC number is 696-001-4.
What is the DSSTox Substance ID of 4-Chloro-2-fluoro-3-methoxyphenylboronic acid?
The DSSTox Substance ID is DTXSID20657510.
Is 4-Chloro-2-fluoro-3-methoxyphenylboronic acid a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.