What is the molecular formula of 4-Carboxy-2-methoxyphenylboronic acid?
The molecular formula is C8H9BO5.
What are the synonyms for 4-Carboxy-2-methoxyphenylboronic acid?
The synonyms are 4-Borono-3-methoxybenzoic acid, 741699-09-2, 4-CARBOXY-2-METHOXYPHENYLBORONIC ACID, 4-(DIHYDROXYBORYL)-3-METHOXYBENZOICACID, MFCD10696665.
What is the molecular weight of 4-Carboxy-2-methoxyphenylboronic acid?
The molecular weight is 195.97 g/mol.
What is the IUPAC name of 4-Carboxy-2-methoxyphenylboronic acid?
The IUPAC name is 4-borono-3-methoxybenzoic acid.
What is the InChI of 4-Carboxy-2-methoxyphenylboronic acid?
The InChI is InChI=1S/C8H9BO5/c1-14-7-4-5(8(10)11)2-3-6(7)9(12)13/h2-4,12-13H,1H3,(H,10,11).
What is the InChIKey of 4-Carboxy-2-methoxyphenylboronic acid?
The InChIKey is ITWXOEQLYFYTJX-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Carboxy-2-methoxyphenylboronic acid?
The canonical SMILES is B(C1=C(C=C(C=C1)C(=O)O)OC)(O)O.
What is the CAS number of 4-Carboxy-2-methoxyphenylboronic acid?
The CAS number is 741699-09-2.
Is 4-Carboxy-2-methoxyphenylboronic acid a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.