What is the molecular formula of 4-Butoxy-2-methylaniline?
The molecular formula of 4-Butoxy-2-methylaniline is C11H17NO.
What is the molecular weight of 4-Butoxy-2-methylaniline?
The molecular weight of 4-Butoxy-2-methylaniline is 179.26 g/mol.
What is the IUPAC name of 4-Butoxy-2-methylaniline?
The IUPAC name of 4-Butoxy-2-methylaniline is 4-butoxy-2-methylaniline.
What is the InChI of 4-Butoxy-2-methylaniline?
The InChI of 4-Butoxy-2-methylaniline is InChI=1S/C11H17NO/c1-3-4-7-13-10-5-6-11(12)9(2)8-10/h5-6,8H,3-4,7,12H2,1-2H3.
What is the InChIKey of 4-Butoxy-2-methylaniline?
The InChIKey of 4-Butoxy-2-methylaniline is OBQQJOIBIBZNAR-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Butoxy-2-methylaniline?
The Canonical SMILES of 4-Butoxy-2-methylaniline is CCCCOC1=CC(=C(C=C1)N)C.
What is the CAS number of 4-Butoxy-2-methylaniline?
The CAS number of 4-Butoxy-2-methylaniline is 150748-89-3.
What is the European Community (EC) number of 4-Butoxy-2-methylaniline?
The European Community (EC) number of 4-Butoxy-2-methylaniline is 871-696-9.
What is the XLogP3 value of 4-Butoxy-2-methylaniline?
The XLogP3 value of 4-Butoxy-2-methylaniline is 2.5.
Is 4-Butoxy-2-methylaniline a canonicalized compound?
Yes, 4-Butoxy-2-methylaniline is a canonicalized compound.