What is the molecular formula of 4-Bromophthalimide?
The molecular formula of 4-Bromophthalimide is C8H4BrNO2.
What is the molecular weight of 4-Bromophthalimide?
The molecular weight of 4-Bromophthalimide is 226.03 g/mol.
What are some synonyms for 4-Bromophthalimide?
Some synonyms for 4-Bromophthalimide are 5-Bromoisoindoline-1,3-dione and 5-Bromo-isoindole-1,3-dione.
What is the IUPAC name of 4-Bromophthalimide?
The IUPAC name of 4-Bromophthalimide is 5-bromoisoindole-1,3-dione.
What is the InChI code for 4-Bromophthalimide?
The InChI code for 4-Bromophthalimide is InChI=1S/C8H4BrNO2/c9-4-1-2-5-6(3-4)8(12)10-7(5)11/h1-3H,(H,10,11,12).
What is the InChIKey for 4-Bromophthalimide?
The InChIKey for 4-Bromophthalimide is GNYICZVGHULCHE-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 4-Bromophthalimide have?
4-Bromophthalimide has 1 hydrogen bond donor count.
What is the topological polar surface area of 4-Bromophthalimide?
The topological polar surface area of 4-Bromophthalimide is 46.2 Ų.
How many heavy atoms are present in the structure of 4-Bromophthalimide?
There are 12 heavy atoms in the structure of 4-Bromophthalimide.
Is 4-Bromophthalimide a canonicalized compound?
Yes, 4-Bromophthalimide is a canonicalized compound.