What is the molecular formula of 4-Bromoisoindolin-1-one?
The molecular formula of 4-Bromoisoindolin-1-one is C8H6BrNO.
What is the molecular weight of 4-Bromoisoindolin-1-one?
The molecular weight of 4-Bromoisoindolin-1-one is 212.04 g/mol.
When was 4-Bromoisoindolin-1-one created in PubChem?
4-Bromoisoindolin-1-one was created in PubChem on December 5, 2007.
When was 4-Bromoisoindolin-1-one last modified in PubChem?
4-Bromoisoindolin-1-one was last modified in PubChem on December 2, 2023.
What is the IUPAC name of 4-Bromoisoindolin-1-one?
The IUPAC name of 4-Bromoisoindolin-1-one is 4-bromo-2,3-dihydroisoindol-1-one.
What is the InChI of 4-Bromoisoindolin-1-one?
The InChI of 4-Bromoisoindolin-1-one is InChI=1S/C8H6BrNO/c9-7-3-1-2-5-6(7)4-10-8(5)11/h1-3H,4H2,(H,10,11).
What is the InChIKey of 4-Bromoisoindolin-1-one?
The InChIKey of 4-Bromoisoindolin-1-one is TYRICULVJRGSTL-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromoisoindolin-1-one?
The canonical SMILES of 4-Bromoisoindolin-1-one is C1C2=C(C=CC=C2Br)C(=O)N1.
What is the CAS number of 4-Bromoisoindolin-1-one?
The CAS number of 4-Bromoisoindolin-1-one is 337536-15-9.