4-Bromoindole-1-carboxylic acid tert-butyl ester

• CAS: 676448-17-2
• Catalog Number: ACM676448172
• Category: Bromine Series
• Molecular Weight: 296.16
• Molecular Formula: C₁₃H₁₄BrNO₂

Custom Q&A

What is the molecular formula of 4-Bromoindole-1-carboxylic acid tert-butyl ester?

The molecular formula is C13H14BrNO2.

What are the synonyms for 4-Bromoindole-1-carboxylic acid tert-butyl ester?

Some synonyms include 1-Boc-4-Bromoindole, tert-butyl 4-bromo-1H-indole-1-carboxylate, and tert-butyl 4-bromoindole-1-carboxylate.

What is the molecular weight of 4-Bromoindole-1-carboxylic acid tert-butyl ester?

The molecular weight is 296.16 g/mol.

What is the IUPAC name of 4-Bromoindole-1-carboxylic acid tert-butyl ester?

The IUPAC name is tert-butyl 4-bromoindole-1-carboxylate.

What is the InChI key of 4-Bromoindole-1-carboxylic acid tert-butyl ester?

The InChI key is ZGBNKNOAADXGOH-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromoindole-1-carboxylic acid tert-butyl ester?

The canonical SMILES is CC(C)(C)OC(=O)N1C=CC2=C1C=CC=C2Br.

How many hydrogen bond donor counts does 4-Bromoindole-1-carboxylic acid tert-butyl ester have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4-Bromoindole-1-carboxylic acid tert-butyl ester have?

It has 2 hydrogen bond acceptor counts.

What is the topological polar surface area of 4-Bromoindole-1-carboxylic acid tert-butyl ester?

The topological polar surface area is 31.2Ų.

Is 4-Bromoindole-1-carboxylic acid tert-butyl ester a canonicalized compound?

Yes, it is a canonicalized compound.