What is the PubChem CID of 4-Bromoheptane?
The PubChem CID of 4-Bromoheptane is 70460.
What is the molecular formula of 4-Bromoheptane?
The molecular formula of 4-Bromoheptane is C7H15Br.
What is the molecular weight of 4-Bromoheptane?
The molecular weight of 4-Bromoheptane is 179.10 g/mol.
What is the IUPAC name of 4-Bromoheptane?
The IUPAC name of 4-Bromoheptane is 4-bromoheptane.
What is the InChI of 4-Bromoheptane?
The InChI of 4-Bromoheptane is InChI=1S/C7H15Br/c1-3-5-7(8)6-4-2/h7H,3-6H2,1-2H3.
What is the InChIKey of 4-Bromoheptane?
The InChIKey of 4-Bromoheptane is BNUTXEKPXPZAIT-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Bromoheptane?
The Canonical SMILES of 4-Bromoheptane is CCCC(CCC)Br.
What is the CAS number of 4-Bromoheptane?
The CAS number of 4-Bromoheptane is 998-93-6.
What is the EC number of 4-Bromoheptane?
The EC number of 4-Bromoheptane is 213-653-3.
What is the XLogP3-AA value of 4-Bromoheptane?
The XLogP3-AA value of 4-Bromoheptane is 3.6.