What is the molecular formula of 4-Bromobenzylamine?
The molecular formula of 4-Bromobenzylamine is C7H8BrN.
What is the molecular weight of 4-Bromobenzylamine?
The molecular weight of 4-Bromobenzylamine is 186.05 g/mol.
What is the IUPAC name of 4-Bromobenzylamine?
The IUPAC name of 4-Bromobenzylamine is (4-bromophenyl)methanamine.
What is the Canonical SMILES of 4-Bromobenzylamine?
The Canonical SMILES of 4-Bromobenzylamine is C1=CC(=CC=C1CN)Br.
What is the InChI of 4-Bromobenzylamine?
The InChI of 4-Bromobenzylamine is InChI=1S/C7H8BrN/c8-7-3-1-6(5-9)2-4-7/h1-4H,5,9H2.
What is the CAS number of 4-Bromobenzylamine?
The CAS number of 4-Bromobenzylamine is 3959-07-7.
What is the XLogP3 value of 4-Bromobenzylamine?
The XLogP3 value of 4-Bromobenzylamine is 1.9.
How many hydrogen bond donor counts does 4-Bromobenzylamine have?
4-Bromobenzylamine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 4-Bromobenzylamine have?
4-Bromobenzylamine has 1 hydrogen bond acceptor count.
What is the topological polar surface area of 4-Bromobenzylamine?
The topological polar surface area of 4-Bromobenzylamine is 26Ų.