What is the molecular formula of 4-Bromobenzyl mercaptan?
The molecular formula of 4-Bromobenzyl mercaptan is C7H7BrS.
What is the molecular weight of 4-Bromobenzyl mercaptan?
The molecular weight of 4-Bromobenzyl mercaptan is 203.10 g/mol.
What is the IUPAC Name of 4-Bromobenzyl mercaptan?
The IUPAC Name of 4-Bromobenzyl mercaptan is (4-bromophenyl)methanethiol.
What is the InChI of 4-Bromobenzyl mercaptan?
The InChI of 4-Bromobenzyl mercaptan is InChI=1S/C7H7BrS/c8-7-3-1-6(5-9)2-4-7/h1-4,9H,5H2.
What is the InChIKey of 4-Bromobenzyl mercaptan?
The InChIKey of 4-Bromobenzyl mercaptan is CUCKXDPCCYHFMQ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromobenzyl mercaptan?
The canonical SMILES of 4-Bromobenzyl mercaptan is C1=CC(=CC=C1CS)Br.
What is the CAS number of 4-Bromobenzyl mercaptan?
The CAS number of 4-Bromobenzyl mercaptan is 19552-10-4.
What is the European Community (EC) number of 4-Bromobenzyl mercaptan?
The European Community (EC) number of 4-Bromobenzyl mercaptan is 674-546-9.
What is the DSSTox Substance ID of 4-Bromobenzyl mercaptan?
The DSSTox Substance ID of 4-Bromobenzyl mercaptan is DTXSID90297189.
What is the Nikkaji Number of 4-Bromobenzyl mercaptan?
The Nikkaji Number of 4-Bromobenzyl mercaptan is J979.030F.