What is the molecular formula of 4-Bromobenzamide?
The molecular formula of 4-Bromobenzamide is C7H6BrNO.
What is the molecular weight of 4-Bromobenzamide?
The molecular weight of 4-Bromobenzamide is 200.03 g/mol.
What is the IUPAC name of 4-Bromobenzamide?
The IUPAC name of 4-Bromobenzamide is 4-bromobenzamide.
What is the InChI of 4-Bromobenzamide?
The InChI of 4-Bromobenzamide is InChI=1S/C7H6BrNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10).
What is the InChIKey of 4-Bromobenzamide?
The InChIKey of 4-Bromobenzamide is ZRWNRAJCPNLYAK-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromobenzamide?
The canonical SMILES of 4-Bromobenzamide is C1=CC(=CC=C1C(=O)N)Br.
What is the CAS number of 4-Bromobenzamide?
The CAS number of 4-Bromobenzamide is 698-67-9.
What is the European Community (EC) number of 4-Bromobenzamide?
The European Community (EC) number of 4-Bromobenzamide is 211-817-9.
What is the UNII of 4-Bromobenzamide?
The UNII of 4-Bromobenzamide is Q5Y2274MYS.
Is 4-Bromobenzamide a canonicalized compound?
Yes, 4-Bromobenzamide is a canonicalized compound.