What is the molecular formula of 4-Bromo-3-(trifluoromethyl)benzenesulfonyl chloride?
The molecular formula is C7H3BrClF3O2S.
What is the molecular weight of 4-Bromo-3-(trifluoromethyl)benzenesulfonyl chloride?
The molecular weight is 323.52 g/mol.
When was 4-Bromo-3-(trifluoromethyl)benzenesulfonyl chloride created?
It was created on July 19, 2005.
When was 4-Bromo-3-(trifluoromethyl)benzenesulfonyl chloride last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 4-Bromo-3-(trifluoromethyl)benzenesulfonyl chloride?
The IUPAC name is 4-bromo-3-(trifluoromethyl)benzenesulfonyl chloride.
What is the InChI of 4-Bromo-3-(trifluoromethyl)benzenesulfonyl chloride?
The InChI is InChI=1S/C7H3BrClF3O2S/c8-6-2-1-4(15(9,13)14)3-5(6)7(10,11)12/h1-3H.
What is the InChIKey of 4-Bromo-3-(trifluoromethyl)benzenesulfonyl chloride?
The InChIKey is QCFIMBHKZZLZAE-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-(trifluoromethyl)benzenesulfonyl chloride?
The canonical SMILES is C1=CC(=C(C=C1S(=O)(=O)Cl)C(F)(F)F)Br.
What other identifiers are associated with 4-Bromo-3-(trifluoromethyl)benzenesulfonyl chloride?
The CAS number is 351003-47-9, the European Community (EC) number is 624-201-3, the DSSTox Substance ID is DTXSID40381027, and the Wikidata ID is Q72513371.
What is the XLogP3 value of 4-Bromo-3-(trifluoromethyl)benzenesulfonyl chloride?
The XLogP3 value is 4.1.
※ Please kindly note that our products are for research use only.