What is the molecular formula of 4-Bromo-3-methylphenol?
The molecular formula of 4-Bromo-3-methylphenol is C7H7BrO.
What is the molecular weight of 4-Bromo-3-methylphenol?
The molecular weight of 4-Bromo-3-methylphenol is 187.03 g/mol.
What is the IUPAC name of 4-Bromo-3-methylphenol?
The IUPAC name of 4-Bromo-3-methylphenol is 4-bromo-3-methylphenol.
What is the InChI of 4-Bromo-3-methylphenol?
The InChI of 4-Bromo-3-methylphenol is InChI=1S/C7H7BrO/c1-5-4-6(9)2-3-7(5)8/h2-4,9H,1H3.
What is the InChIKey of 4-Bromo-3-methylphenol?
The InChIKey of 4-Bromo-3-methylphenol is GPOQODYGMUTOQL-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-methylphenol?
The canonical SMILES of 4-Bromo-3-methylphenol is CC1=C(C=CC(=C1)O)Br.
What is the CAS number of 4-Bromo-3-methylphenol?
The CAS number of 4-Bromo-3-methylphenol is 14472-14-1.
What is the European Community (EC) number of 4-Bromo-3-methylphenol?
The European Community (EC) number of 4-Bromo-3-methylphenol is 238-464-3.
What is the UNII of 4-Bromo-3-methylphenol?
The UNII of 4-Bromo-3-methylphenol is 9KTP3W6RV2.
Is 4-Bromo-3-methylphenol a canonicalized compound?
Yes, 4-Bromo-3-methylphenol is a canonicalized compound.