What is the molecular formula of 4-Bromo-3-iodotoluene?
The molecular formula of 4-Bromo-3-iodotoluene is C7H6BrI.
What is the molecular weight of 4-Bromo-3-iodotoluene?
The molecular weight of 4-Bromo-3-iodotoluene is 296.93 g/mol.
What is the IUPAC name of 4-Bromo-3-iodotoluene?
The IUPAC name of 4-Bromo-3-iodotoluene is 1-bromo-2-iodo-4-methylbenzene.
What is the InChI of 4-Bromo-3-iodotoluene?
The InChI of 4-Bromo-3-iodotoluene is InChI=1S/C7H6BrI/c1-5-2-3-6(8)7(9)4-5/h2-4H,1H3.
What is the InChIKey of 4-Bromo-3-iodotoluene?
The InChIKey of 4-Bromo-3-iodotoluene is FLOUOTRVXNQGKP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-iodotoluene?
The canonical SMILES of 4-Bromo-3-iodotoluene is CC1=CC(=C(C=C1)Br)I.
What is the CAS number of 4-Bromo-3-iodotoluene?
The CAS number of 4-Bromo-3-iodotoluene is 858841-53-9.
What is the XLogP3-AA value of 4-Bromo-3-iodotoluene?
The XLogP3-AA value of 4-Bromo-3-iodotoluene is 3.6.
How many hydrogen bond donor counts does 4-Bromo-3-iodotoluene have?
4-Bromo-3-iodotoluene does not have any hydrogen bond donor count (0).
How many rotatable bond counts does 4-Bromo-3-iodotoluene have?
4-Bromo-3-iodotoluene does not have any rotatable bond count (0).