What is the molecular formula of 4-Bromo-3-ethoxyaniline hydrochloride?
The molecular formula of 4-Bromo-3-ethoxyaniline hydrochloride is C8H11BrClNO.
What is the molecular weight of 4-Bromo-3-ethoxyaniline hydrochloride?
The molecular weight of 4-Bromo-3-ethoxyaniline hydrochloride is 252.53 g/mol.
What are the synonyms of 4-Bromo-3-ethoxyaniline hydrochloride?
The synonyms of 4-Bromo-3-ethoxyaniline hydrochloride are 846023-33-4, 125756-95-8, 4-Bromo-3-ethoxyaniline HCl, and 4-bromo-3-ethoxyaniline;hydrochloride.
What is the IUPAC name of 4-Bromo-3-ethoxyaniline hydrochloride?
The IUPAC name of 4-Bromo-3-ethoxyaniline hydrochloride is 4-bromo-3-ethoxyaniline;hydrochloride.
What is the InChI of 4-Bromo-3-ethoxyaniline hydrochloride?
The InChI of 4-Bromo-3-ethoxyaniline hydrochloride is InChI=1S/C8H10BrNO.ClH/c1-2-11-8-5-6(10)3-4-7(8)9;/h3-5H,2,10H2,1H3;1H.
What is the InChIKey of 4-Bromo-3-ethoxyaniline hydrochloride?
The InChIKey of 4-Bromo-3-ethoxyaniline hydrochloride is CVVLNBLBIWBEPT-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-3-ethoxyaniline hydrochloride?
The canonical SMILES of 4-Bromo-3-ethoxyaniline hydrochloride is CCOC1=C(C=CC(=C1)N)Br.Cl.
What is the CAS number of 4-Bromo-3-ethoxyaniline hydrochloride?
The CAS number of 4-Bromo-3-ethoxyaniline hydrochloride is 846023-33-4.
What is the hydrogen bond donor count of 4-Bromo-3-ethoxyaniline hydrochloride?
The hydrogen bond donor count of 4-Bromo-3-ethoxyaniline hydrochloride is 2.
Is 4-Bromo-3-ethoxyaniline hydrochloride a canonicalized compound?
Yes, 4-Bromo-3-ethoxyaniline hydrochloride is a canonicalized compound.
※ Please kindly note that our products are for research use only.