34598-49-7 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C6H4BrClIN.
The molecular weight of the compound is 332.36 g/mol.
The IUPAC name of the compound is 4-bromo-3-chloro-2-iodoaniline.
The InChI of the compound is InChI=1S/C6H4BrClIN/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2.
The InChIKey of the compound is CWBOOQXLEPXAAS-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=C(C(=C1N)I)Cl)Br.
The CAS number of the compound is 1426566-90-6.
The XLogP3-AA value of the compound is 3.2.
The compound has a hydrogen bond donor count of 1.
The compound has a rotatable bond count of 0.
Download
×