What is the molecular formula of 4-Bromo-2-nitrophenol?
The molecular formula of 4-Bromo-2-nitrophenol is C6H4BrNO3.
What is the molecular weight of 4-Bromo-2-nitrophenol?
The molecular weight of 4-Bromo-2-nitrophenol is 218.00 g/mol.
What is the IUPAC name of 4-Bromo-2-nitrophenol?
The IUPAC name of 4-Bromo-2-nitrophenol is 4-bromo-2-nitrophenol.
What is the InChI of 4-Bromo-2-nitrophenol?
The InChI of 4-Bromo-2-nitrophenol is InChI=1S/C6H4BrNO3/c7-4-1-2-6(9)5(3-4)8(10)11/h1-3,9H.
What is the InChIKey of 4-Bromo-2-nitrophenol?
The InChIKey of 4-Bromo-2-nitrophenol is CUTFAPGINUFNQM-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-nitrophenol?
The canonical SMILES of 4-Bromo-2-nitrophenol is C1=CC(=C(C=C1Br)[N+](=O)[O-])O.
What is the CAS number of 4-Bromo-2-nitrophenol?
The CAS number of 4-Bromo-2-nitrophenol is 7693-52-9.
What is the European Community (EC) number of 4-Bromo-2-nitrophenol?
The European Community (EC) number of 4-Bromo-2-nitrophenol is 231-707-4.
What is the UNII of 4-Bromo-2-nitrophenol?
The UNII of 4-Bromo-2-nitrophenol is SNK5JLK3FA.