In homogeneous catalytic system, transition metal can catalyze 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester to synthesize aryl borate compounds.
What is the molecular formula of 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester?
The molecular formula is C17H20BClN2O3.
What is the molecular weight of 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester?
The molecular weight is 346.6 g/mol.
When was 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester created?
It was created on March 14, 2010.
What is the InChI of 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester?
The InChI is InChI=1S/C17H20BClN2O3/c1-16(2)17(3,4)24-18(23-16)13-10-20-15(19)21-14(13)22-11-12-8-6-5-7-9-12/h5-10H,11H2,1-4H3.
What is the InChIKey of 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester?
The InChIKey is YXXPVSCUVOPQBT-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester?
The Canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2OCC3=CC=CC=C3)Cl.
What is the CAS number of 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester?
The CAS number is 1073354-22-9.
What is the European Community (EC) Number of 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester?
The European Community (EC) Number is 681-263-4.
What is the DSSTox Substance ID of 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester?
The DSSTox Substance ID is DTXSID20660640.
Is 4-Benzyloxy-2-chloropyrimidine-5-boronic acid pinacol ester canonicalized?
Yes, the compound is canonicalized according to PubChem.
※ Please kindly note that our products are for research use only.