What is the molecular formula of 4-Androsten-4-ol-3,17-dione acetate?
The molecular formula is C21H28O4.
What are the synonyms of 4-Androsten-4-ol-3,17-dione acetate?
The synonyms are 4-Acetoxy-4-androstene-3,17-dione and 61630-32-8.
What is the molecular weight of 4-Androsten-4-ol-3,17-dione acetate?
The molecular weight is 344.4 g/mol.
What is the IUPAC name of 4-Androsten-4-ol-3,17-dione acetate?
The IUPAC name is [(8R,9S,10R,13S,14S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-4-yl] acetate.
What is the InChI of 4-Androsten-4-ol-3,17-dione acetate?
The InChI is InChI=1S/C21H28O4/c1-12(22)25-19-16-5-4-13-14-6-7-18(24)21(14,3)10-8-15(13)20(16,2)11-9-17(19)23/h13-15H,4-11H2,1-3H3/t13-,14-,15-,20+,21-/m0/s1.
What is the InChIKey of 4-Androsten-4-ol-3,17-dione acetate?
The InChIKey is LRXSFNGKRCOHRS-VMRCMBGLSA-N.
What is the Canonical SMILES of 4-Androsten-4-ol-3,17-dione acetate?
The Canonical SMILES is CC(=O)OC1=C2CCC3C4CCC(=O)C4(CCC3C2(CCC1=O)C)C.
What is the Isomeric SMILES of 4-Androsten-4-ol-3,17-dione acetate?
The Isomeric SMILES is CC(=O)OC1=C2CC[C@H]3[C@@H]4CCC(=O)[C@]4(CC[C@@H]3[C@]2(CCC1=O)C)C.
What is the CAS number of 4-Androsten-4-ol-3,17-dione acetate?
The CAS number is 61630-32-8.
※ Please kindly note that our products are for research use only.