What is the molecular formula of 4-Androsten-3,17-dione 19-aldehyde?
The molecular formula is C19H24O3.
What is the molecular weight of 4-Androsten-3,17-dione 19-aldehyde?
The molecular weight is 300.4 g/mol.
What is the IUPAC name of 4-Androsten-3,17-dione 19-aldehyde?
The IUPAC name is (8R,9S,10S,13S,14S)-13-methyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde.
What is the InChI of 4-Androsten-3,17-dione 19-aldehyde?
The InChI is InChI=1S/C19H24O3/c1-18-8-7-16-14(15(18)4-5-17(18)22)3-2-12-10-13(21)6-9-19(12,16)11-20/h10-11,14-16H,2-9H2,1H3/t14-,15-,16-,18-,19+/m0/s1.
What is the InChIKey of 4-Androsten-3,17-dione 19-aldehyde?
The InChIKey is XRCFMDPVHKVRDJ-BGJMDTOESA-N.
What is the Canonical SMILES of 4-Androsten-3,17-dione 19-aldehyde?
The Canonical SMILES is CC12CCC3C(C1CCC2=O)CCC4=CC(=O)CCC34C=O.
What is the CAS number of 4-Androsten-3,17-dione 19-aldehyde?
The CAS number is 968-49-0.
What is the UNII of 4-Androsten-3,17-dione 19-aldehyde?
The UNII is X07F7694NW.
What is the topological polar surface area of 4-Androsten-3,17-dione 19-aldehyde?
The topological polar surface area is 51.2 Ų.
※ Please kindly note that our products are for research use only.