What is the molecular formula of 4-Androsten-3,16-dione?
The molecular formula of 4-Androsten-3,16-dione is C19H26O2.
What are the synonyms for 4-Androsten-3,16-dione?
The synonyms for 4-Androsten-3,16-dione are Androst-4-ene-3,16-dione, 4-ANDROSTEN-3,16-DIONE, 571-52-8, and SCHEMBL3676406.
What is the molecular weight of 4-Androsten-3,16-dione?
The molecular weight of 4-Androsten-3,16-dione is 286.4 g/mol.
What is the IUPAC name of 4-Androsten-3,16-dione?
The IUPAC name of 4-Androsten-3,16-dione is (8S,9S,10R,13R,14S)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,17-decahydro-1H-cyclopenta[a]phenanthrene-3,16-dione.
What is the InChI of 4-Androsten-3,16-dione?
The InChI of 4-Androsten-3,16-dione is InChI=1S/C19H26O2/c1-18-7-6-16-15(17(18)10-14(21)11-18)4-3-12-9-13(20)5-8-19(12,16)2/h9,15-17H,3-8,10-11H2,1-2H3/t15-,16+,17+,18-,19+/m1/s1.
What is the InChIKey of 4-Androsten-3,16-dione?
The InChIKey of 4-Androsten-3,16-dione is LAAYSLQQLRKNGI-SPOLIRPYSA-N.
What is the canonical SMILES of 4-Androsten-3,16-dione?
The canonical SMILES of 4-Androsten-3,16-dione is CC12CCC3C(C1CC(=O)C2)CCC4=CC(=O)CCC34C.
What is the isomeric SMILES of 4-Androsten-3,16-dione?
The isomeric SMILES of 4-Androsten-3,16-dione is C[C@]12CC[C@H]3[C@H]([C@@H]1CC(=O)C2)CCC4=CC(=O)CC[C@]34C.
What is the XLogP3 value of 4-Androsten-3,16-dione?
The XLogP3 value of 4-Androsten-3,16-dione is 3.
Is 4-Androsten-3,16-dione a canonicalized compound?
Yes, 4-Androsten-3,16-dione is a canonicalized compound according to PubChem.