What is the PubChem CID for 4-Aminothiobenzamide?
The PubChem CID for 4-Aminothiobenzamide is 2756559.
What is the molecular formula of 4-Aminothiobenzamide?
The molecular formula of 4-Aminothiobenzamide is C7H8N2S.
What are the synonyms for 4-Aminothiobenzamide?
The synonyms for 4-Aminothiobenzamide include 4-aminobenzenecarbothioamide, 4-AMINOBENZOTHIOAMIDE, and Benzamide, p-aminothio.
What is the molecular weight of 4-Aminothiobenzamide?
The molecular weight of 4-Aminothiobenzamide is 152.22 g/mol.
What is the IUPAC name of 4-Aminothiobenzamide?
The IUPAC name of 4-Aminothiobenzamide is 4-aminobenzenecarbothioamide.
What is the InChI of 4-Aminothiobenzamide?
The InChI of 4-Aminothiobenzamide is InChI=1S/C7H8N2S/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H2,9,10).
What is the InChIKey of 4-Aminothiobenzamide?
The InChIKey of 4-Aminothiobenzamide is LZJVSPPXXGXGQL-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-Aminothiobenzamide?
The Canonical SMILES of 4-Aminothiobenzamide is C1=CC(=CC=C1C(=S)N)N.
What is the CAS number of 4-Aminothiobenzamide?
The CAS number of 4-Aminothiobenzamide is 4714-67-4.
What is the ChEMBL ID of 4-Aminothiobenzamide?
The ChEMBL ID of 4-Aminothiobenzamide is CHEMBL2441353.