What is the PubChem CID of 4-Aminophenylboronic acid hydrochloride?
The PubChem CID of 4-Aminophenylboronic acid hydrochloride is 2734614.
What is the molecular formula of 4-Aminophenylboronic acid hydrochloride?
The molecular formula of 4-Aminophenylboronic acid hydrochloride is C6H9BClNO2.
What is the molecular weight of 4-Aminophenylboronic acid hydrochloride?
The molecular weight of 4-Aminophenylboronic acid hydrochloride is 173.41 g/mol.
What are the synonyms for 4-Aminophenylboronic acid hydrochloride?
The synonyms for 4-Aminophenylboronic acid hydrochloride include (4-aminophenyl)boronic acid hydrochloride, 4-Aminobenzeneboronic acid hydrochloride, and 4-Aminophenylboronic acid, HCl.
What is the IUPAC name of 4-Aminophenylboronic acid hydrochloride?
The IUPAC name of 4-Aminophenylboronic acid hydrochloride is (4-aminophenyl)boronic acid;hydrochloride.
What is the InChI of 4-Aminophenylboronic acid hydrochloride?
The InChI of 4-Aminophenylboronic acid hydrochloride is InChI=1S/C6H8BNO2.ClH/c8-6-3-1-5(2-4-6)7(9)10;/h1-4,9-10H,8H2;1H.
What is the InChIKey of 4-Aminophenylboronic acid hydrochloride?
The InChIKey of 4-Aminophenylboronic acid hydrochloride is QBYGJJSFMOVYOA-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Aminophenylboronic acid hydrochloride?
The canonical SMILES of 4-Aminophenylboronic acid hydrochloride is B(C1=CC=C(C=C1)N)(O)O.Cl.
What is the CAS number of 4-Aminophenylboronic acid hydrochloride?
The CAS number of 4-Aminophenylboronic acid hydrochloride is 80460-73-7.
Is 4-Aminophenylboronic acid hydrochloride a canonicalized compound?
Yes, 4-Aminophenylboronic acid hydrochloride is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.