What is the molecular weight of 4-Amino-p-terphenyl?
The molecular weight of 4-Amino-p-terphenyl is 245.3 g/mol.
What is the IUPAC name of 4-Amino-p-terphenyl?
The IUPAC name of 4-Amino-p-terphenyl is 4-(4-phenylphenyl)aniline.
What is the InChI of 4-Amino-p-terphenyl?
The InChI of 4-Amino-p-terphenyl is InChI=1S/C18H15N/c19-18-12-10-17(11-13-18)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-13H,19H2.
What is the InChIKey of 4-Amino-p-terphenyl?
The InChIKey of 4-Amino-p-terphenyl is ATGIXVUZFPZOHP-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Amino-p-terphenyl?
The canonical SMILES of 4-Amino-p-terphenyl is C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)N.
What is the CAS number of 4-Amino-p-terphenyl?
The CAS number of 4-Amino-p-terphenyl is 7293-45-0.
What is the molecular weight of 4-Amino-p-terphenyl according to PubChem?
The molecular weight of 4-Amino-p-terphenyl according to PubChem is 245.3 g/mol.
What is the XLogP3 value of 4-Amino-p-terphenyl?
The XLogP3 value of 4-Amino-p-terphenyl is 4.5.
How many hydrogen bond donor counts does 4-Amino-p-terphenyl have?
4-Amino-p-terphenyl has 1 hydrogen bond donor count.
How many rotatable bond counts does 4-Amino-p-terphenyl have?
4-Amino-p-terphenyl has 2 rotatable bond counts.