The molecular formula of the compound is C7H8ClNOS.
What are the synonyms of the compound?
The synonyms of the compound are 108046-16-8, 4-amino-4,5-dihydro-6H-cyclopenta[b]thiophen-6-one hydrochloride, 4-Amino-4H-cyclopenta[b]thiophen-6(5H)-one hydrochloride, and 4-amino-4,5-dihydrocyclopenta[b]thiophen-6-one;hydrochloride.
What is the molecular weight of the compound?
The molecular weight of the compound is 189.66 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-amino-4,5-dihydrocyclopenta[b]thiophen-6-one;hydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C7H7NOS.ClH/c8-5-3-6(9)7-4(5)1-2-10-7;/h1-2,5H,3,8H2;1H.
What is the InChIKey of the compound?
The InChIKey of the compound is VLJFWONKQWZPGU-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1C(C2=C(C1=O)SC=C2)N.Cl.
What is the ChEMBL ID of the compound?
The ChEMBL ID of the compound is CHEMBL1964712.
What is the NSC Number of the compound?
The NSC Number of the compound is 687361.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 2.
※ Please kindly note that our products are for research use only.