What is the molecular formula of 4-Amino-2-iodophenol?
The molecular formula of 4-Amino-2-iodophenol is C6H6INO.
What is the molecular weight of 4-Amino-2-iodophenol?
The molecular weight of 4-Amino-2-iodophenol is 235.02 g/mol.
What is the IUPAC name of 4-Amino-2-iodophenol?
The IUPAC name of 4-Amino-2-iodophenol is 4-amino-2-iodophenol.
What is the InChI of 4-Amino-2-iodophenol?
The InChI of 4-Amino-2-iodophenol is InChI=1S/C6H6INO/c7-5-3-4(8)1-2-6(5)9/h1-3,9H,8H2.
What is the InChIKey of 4-Amino-2-iodophenol?
The InChIKey of 4-Amino-2-iodophenol is GUGSDWSSHLBVST-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Amino-2-iodophenol?
The canonical SMILES of 4-Amino-2-iodophenol is C1=CC(=C(C=C1N)I)O.
What is the CAS number of 4-Amino-2-iodophenol?
The CAS number of 4-Amino-2-iodophenol is 89640-51-7.
What is the EC number of 4-Amino-2-iodophenol?
The EC number of 4-Amino-2-iodophenol is 694-409-7.
What is the monoisotopic mass of 4-Amino-2-iodophenol?
The monoisotopic mass of 4-Amino-2-iodophenol is 234.94941 g/mol.
Is 4-Amino-2-iodophenol a canonicalized compound?
Yes, 4-Amino-2-iodophenol is a canonicalized compound.