What is the molecular weight of 4-Amino-2-fluorophenylboronic acid pinacol ester?
The molecular weight of 4-Amino-2-fluorophenylboronic acid pinacol ester is 237.08 g/mol.
What is the IUPAC Name of 4-Amino-2-fluorophenylboronic acid pinacol ester?
The IUPAC Name of 4-Amino-2-fluorophenylboronic acid pinacol ester is 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
What is the InChI of 4-Amino-2-fluorophenylboronic acid pinacol ester?
The InChI of 4-Amino-2-fluorophenylboronic acid pinacol ester is InChI=1S/C12H17BFNO2/c1-11(2)12(3,4)17-13(16-11)9-6-5-8(15)7-10(9)14/h5-7H,15H2,1-4H3.
What is the InChIKey of 4-Amino-2-fluorophenylboronic acid pinacol ester?
The InChIKey of 4-Amino-2-fluorophenylboronic acid pinacol ester is FLMNWVXAEGUVNY-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Amino-2-fluorophenylboronic acid pinacol ester?
The canonical SMILES of 4-Amino-2-fluorophenylboronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)N)F.
What is the CAS number of 4-Amino-2-fluorophenylboronic acid pinacol ester?
The CAS number of 4-Amino-2-fluorophenylboronic acid pinacol ester is 819057-45-9.
What is the European Community (EC) Number of 4-Amino-2-fluorophenylboronic acid pinacol ester?
The European Community (EC) Number of 4-Amino-2-fluorophenylboronic acid pinacol ester is 690-890-2.
What is the DSSTox Substance ID of 4-Amino-2-fluorophenylboronic acid pinacol ester?
The DSSTox Substance ID of 4-Amino-2-fluorophenylboronic acid pinacol ester is DTXSID30660651.
Is 4-Amino-2-fluorophenylboronic acid pinacol ester a canonicalized compound?
Yes, 4-Amino-2-fluorophenylboronic acid pinacol ester is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.