What is the molecular formula of 4,6-Dichloropyrimidine?
The molecular formula of 4,6-Dichloropyrimidine is C4H2Cl2N2.
What is the molecular weight of 4,6-Dichloropyrimidine?
The molecular weight of 4,6-Dichloropyrimidine is 148.98 g/mol.
What is the IUPAC name of 4,6-Dichloropyrimidine?
The IUPAC name of 4,6-Dichloropyrimidine is 4,6-dichloropyrimidine.
What is the InChI of 4,6-Dichloropyrimidine?
The InChI of 4,6-Dichloropyrimidine is InChI=1S/C4H2Cl2N2/c5-3-1-4(6)8-2-7-3/h1-2H.
What is the InChIKey of 4,6-Dichloropyrimidine?
The InChIKey of 4,6-Dichloropyrimidine is XJPZKYIHCLDXST-UHFFFAOYSA-N.
What is the canonical SMILES of 4,6-Dichloropyrimidine?
The canonical SMILES of 4,6-Dichloropyrimidine is C1=C(N=CN=C1Cl)Cl.
What is the CAS number of 4,6-Dichloropyrimidine?
The CAS number of 4,6-Dichloropyrimidine is 1193-21-1.
What is the EC number of 4,6-Dichloropyrimidine?
The EC number of 4,6-Dichloropyrimidine is 214-770-2.
What is the UNII of 4,6-Dichloropyrimidine?
The UNII of 4,6-Dichloropyrimidine is TTE9SA8H44.