4-(4-tert-Butyl-phenoxy)-3-nitro-benzaldehyde

• Catalog Number: ACMA00002727
• Category: Ethers
• Molecular Weight: 299.32
• Molecular Formula: C₁₇H₁₆O₄
• Hazard Statements: H317-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound with PubChem CID 2384251?

The molecular formula is C17H17NO4.

When was the compound created in PubChem?

It was created on July 15, 2005.

What is the molecular weight of the compound?

The molecular weight is 299.32 g/mol.

What is the Canonical SMILES representation of the compound?

CC(C)(C)C1=CC=C(C=C1)OC2=C(C=C(C=C2)C=O)[N+](=O)[O-]

How many hydrogen bond acceptors does the compound have?

It has 4 hydrogen bond acceptors.

What is the topological polar surface area of the compound?

The topological polar surface area is 72.1Ų.

Is the compound's structure canonicalized?

Yes, the compound's structure is canonicalized.

How many rotatable bonds does the compound have?

It has 4 rotatable bonds.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 4.4.

How many heavy atoms does the compound contain?

The compound contains 22 heavy atoms.