What is the molecular formula of 4,4'-sulfonyldiphenol?
The molecular formula of 4,4'-sulfonyldiphenol is C12H10O4S.
What is the molecular weight of 4,4'-sulfonyldiphenol?
The molecular weight of 4,4'-sulfonyldiphenol is 250.27 g/mol.
What is the IUPAC name of 4,4'-sulfonyldiphenol?
The IUPAC name of 4,4'-sulfonyldiphenol is 4-(4-hydroxyphenyl)sulfonylphenol.
What is the InChI of 4,4'-sulfonyldiphenol?
The InChI of 4,4'-sulfonyldiphenol is InChI=1S/C12H10O4S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8,13-14H.
What is the InChIKey of 4,4'-sulfonyldiphenol?
The InChIKey of 4,4'-sulfonyldiphenol is VPWNQTHUCYMVMZ-UHFFFAOYSA-N.
What is the canonical SMILES of 4,4'-sulfonyldiphenol?
The canonical SMILES of 4,4'-sulfonyldiphenol is C1=CC(=CC=C1O)S(=O)(=O)C2=CC=C(C=C2)O.
What is the CAS number of 4,4'-sulfonyldiphenol?
The CAS number of 4,4'-sulfonyldiphenol is 80-09-1.
What are the synonyms of 4,4'-sulfonyldiphenol?
The synonyms of 4,4'-sulfonyldiphenol are Bisphenol S, Bis(4-hydroxyphenyl) sulfone, and Phenol, 4,4'-sulfonylbis-.
What is the hydrogen bond donor count of 4,4'-sulfonyldiphenol?
The hydrogen bond donor count of 4,4'-sulfonyldiphenol is 2.
What is the hydrogen bond acceptor count of 4,4'-sulfonyldiphenol?
The hydrogen bond acceptor count of 4,4'-sulfonyldiphenol is 4.