4-(4-Methoxybenzyloxy)-3-methoxyphenol

• Catalog Number: ACMA00002511
• Category: Ethers
• Molecular Weight: 260.29
• Molecular Formula: C₁₅H₁₄O₃
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C15H16O4.

What is the molecular weight of the compound?

The molecular weight of the compound is 260.28 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-methoxy-4-[(4-methoxyphenyl)methoxy]phenol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C15H16O4/c1-17-13-6-3.

What is the InChIKey of the compound?

The InChIKey of the compound is OFTVDVWLBKDHRA-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COC1=CC=C(C=C1)COC2=C(C=C(C=C2)O)OC.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 3.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 5 rotatable bond counts.