What is the molecular formula of 4,4'-Dimercaptostilbene?
The molecular formula of 4,4'-Dimercaptostilbene is C14H14S2.
What are the synonyms of 4,4'-Dimercaptostilbene?
The synonym of 4,4'-Dimercaptostilbene is 4,4-dimercaptostilbene.
What is the molecular weight of 4,4'-Dimercaptostilbene?
The molecular weight of 4,4'-Dimercaptostilbene is 246.4 g/mol.
What is the IUPAC name of 4,4'-Dimercaptostilbene?
The IUPAC name of 4,4'-Dimercaptostilbene is 4-(2-phenylethenyl)cyclohexa-2,4-diene-1,1-dithiol.
What is the InChI of 4,4'-Dimercaptostilbene?
The InChI of 4,4'-Dimercaptostilbene is InChI=1S/C14H14S2/c15-14(16)10-8-13(9-11-14)7-6-12-4-2-1-3-5-12/h1-10,15-16H,11H2.
What is the InChIKey of 4,4'-Dimercaptostilbene?
The InChIKey of 4,4'-Dimercaptostilbene is XNHGFCDVPHOQIV-UHFFFAOYSA-N.
What is the canonical SMILES of 4,4'-Dimercaptostilbene?
The canonical SMILES of 4,4'-Dimercaptostilbene is C1C=C(C=CC1(S)S)C=CC2=CC=CC=C2.
What is the XLogP3-AA value of 4,4'-Dimercaptostilbene?
The XLogP3-AA value of 4,4'-Dimercaptostilbene is 4.1.
How many hydrogen bond donor counts does 4,4'-Dimercaptostilbene have?
4,4'-Dimercaptostilbene has 2 hydrogen bond donor counts.
How many rotatable bond counts does 4,4'-Dimercaptostilbene have?
4,4'-Dimercaptostilbene has 2 rotatable bond counts.