The molecular formula of the compound is C14H11BrO2.
What are the synonyms of the compound?
The synonyms of the compound are 4-[(3-bromobenzyl)oxy]benzaldehyde, 588676-02-2, 4-[(3-bromophenyl)methoxy]benzaldehyde, 4-((3-Bromobenzyl)oxy)benzaldehyde, and 4-(3-Bromobenzyloxy)Benzaldehyde.
What is the molecular weight of the compound?
The molecular weight of the compound is 291.14 g/mol.
When was the compound created?
The compound was created on July 14, 2005.
When was the compound last modified?
The compound was last modified on November 25, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-[(3-bromophenyl)methoxy]benzaldehyde.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C14H11BrO2/c15-13-3-1-2-12(8-13)10-17-14-6-4-11(9-16)5-7-14/h1-9H,10H2.
What is the InChIKey of the compound?
The InChIKey of the compound is RNVLQBDBEJCTRG-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC(=CC(=C1)Br)COC2=CC=C(C=C2)C=O.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 3.5.
※ Please kindly note that our products are for research use only.