What is the molecular formula of the compound with PubChem CID 24213775?
The molecular formula is C16H14O4.
What are the synonyms of the compound with PubChem CID 24213775?
The synonyms are 952183-13-0, 4-(3,4-Dihydro-2H-1,5-benzodioxepin-7-yl)-benzenecarboxylic acid, 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)benzoic acid, 4-(3,4-Dihydro-2H-benzo[b][1,4]dioxepin-7-yl)benzoic acid, and 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)benzenecarboxylic acid.
What is the molecular weight of the compound with PubChem CID 24213775?
The molecular weight is 270.28 g/mol.
What is the IUPAC name of the compound with PubChem CID 24213775?
The IUPAC name is 4-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)benzoic acid.
What is the InChI of the compound with PubChem CID 24213775?
The InChI is InChI=1S/C16H14O4/c17-16(18)12-4-2-11(3-5-12)13-6-7-14-15(10-13)20-9-1-8-19-14/h2-7,10H,1,8-9H2,(H,17,18).
What is the InChIKey of the compound with PubChem CID 24213775?
The InChIKey is GJYLMDBVMSOLSL-UHFFFAOYSA-N.
What is the canonical SMILES of the compound with PubChem CID 24213775?
The canonical SMILES is C1COC2=C(C=C(C=C2)C3=CC=C(C=C3)C(=O)O).
What is the XLogP3-AA value of the compound with PubChem CID 24213775?
The XLogP3-AA value is 3.1.
How many hydrogen bond donor counts does the compound with PubChem CID 24213775 have?
The compound has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does the compound with PubChem CID 24213775 have?
The compound has 4 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.