CAS
1150114-43-4 Purity
---
1150114-43-4 Purity
---
Shopping basket
4-(2-Hydroxypropan-2-yl)pyridine-2-boronic acid
CAS
1310385-00-2
Catalog Number
ACM1310385002
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of this compound?
The molecular formula is C8H12BNO3.
What is the molecular weight of the compound?
The molecular weight is 181.00 g/mol.
What is the IUPAC name of the compound?
The IUPAC name is [4-(2-hydroxypropan-2-yl)pyridin-2-yl]boronic acid.
What is the InChI of the compound?
The InChI is InChI=1S/C8H12BNO3/c1-8(2,11)6-3-4-10-7(5-6)9(12)13/h3-5,11-13H,1-2H3.
What is the InChIKey of the compound?
The InChIKey is LSXVCYFWLXDKSK-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is B(C1=NC=CC(=C1)C(C)(C)O)(O)O.
What is the CAS number of the compound?
The CAS number is 1310385-00-2.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count is 3.
What is the hydrogen bond acceptor count of the compound?
The hydrogen bond acceptor count is 4.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Please kindly note that our products are for research use only.
Recommended Products
