The molecular formula of the compound is C13H13Cl2NO.
What are the synonyms for the compound?
The synonyms for the compound are 1170147-57-5, 4-(2-chlorophenoxy)benzylamine hydrochloride, 4-(2-CHLOROPHENOXY)BENZYLAMINE HCL, (4-(2-Chlorophenoxy)phenyl)methanamine hydrochloride, and [4-(2-chlorophenoxy)phenyl]methanamine;hydrochloride.
What is the molecular weight of the compound?
The molecular weight of the compound is 270.15 g/mol.
What is the parent compound of the compound?
The parent compound of the compound is CID 5152206 ([4-(2-Chlorophenoxy)phenyl]methanamine).
What are the component compounds of the compound?
The component compounds of the compound are CID 5152206 ([4-(2-Chlorophenoxy)phenyl]methanamine) and CID 313 (Hydrochloric Acid).
When was the compound created?
The compound was created on November 16, 2007.
When was the compound last modified?
The compound was last modified on November 25, 2023.
What is the IUPAC Name of the compound?
The IUPAC Name of the compound is [4-(2-chlorophenoxy)phenyl]methanamine;hydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C13H12ClNO.ClH/c14-12-3-1-2-4-13(12)16-11-7-5-10(9-15)6-8-11;/h1-8H,9,15H2;1H.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is C1=CC=C(C(=C1)OC2=CC=C(C=C2)CN)Cl.Cl.
※ Please kindly note that our products are for research use only.