The molecular formula of the compound is C16H14ClFO3.
What are the synonyms for the compound?
The synonyms for the compound are 4-[(2-chloro-4-fluorobenzyl)oxy]-3-ethoxybenzaldehyde, 588713-64-8, 4-[(2-chloro-4-fluorophenyl)methoxy]-3-ethoxybenzaldehyde, and 4-((2-Chloro-4-fluorobenzyl)oxy)-3-ethoxybenzaldehyde.
What is the molecular weight of the compound?
The molecular weight of the compound is 308.73 g/mol.
When was the compound created?
The compound was created on September 26, 2005.
When was the compound last modified?
The compound was last modified on November 25, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-[(2-chloro-4-fluorophenyl)methoxy]-3-ethoxybenzaldehyde.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C16H14ClFO3/c1-2-20-16-7-11(9-19)3-6-15(16)21-10-12-4-5-13(18)8-14(12)17/h3-9H,2,10H2,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is UDQMSQKCINBGRF-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CCOC1=C(C=CC(=C1)C=O)OCC2=C(C=C(C=C2)F)Cl.
How many hydrogen bond acceptor counts does the compound have?
The compound has 4 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.