The molecular formula of the compound is C11H18N2.
What are the synonyms of the compound?
The synonyms of the compound are 4-(2-aminopropyl)-N,N-dimethylaniline, 57580-63-9, [4-(2-Amino-propyl)-phenyl]-dimethyl-amine, SCHEMBL7519175, DTXSID20388817.
What is the molecular weight of the compound?
The molecular weight of the compound is 178.27 g/mol.
When was the compound created and last modified?
The compound was created on 2005-08-09 and last modified on 2023-11-25.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 4-(2-aminopropyl)-N,N-dimethylaniline.
What is the InChI key of the compound?
The InChI key of the compound is RWZBJXQDQJZOLY-UHFFFAOYSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is CC(CC1=CC=C(C=C1)N(C)C)N.
What is the CAS number of the compound?
The CAS number of the compound is 57580-63-9.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 1.9.
How many hydrogen bond donor count does the compound have?
The compound has one hydrogen bond donor count.
※ Please kindly note that our products are for research use only.