4-[2-Amino-6-[(1R)-1-[4-chloro-2-(3-methyl-1H-pyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]-4-pyrimidinyl]-L-phenylalanine ethyl ester N-benzoylglycine salt
4-[2-Amino-6-[(1R)-1-[4-chloro-2-(3-methyl-1H-pyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]-4-pyrimidinyl]-L-phenylalanine ethyl ester N-benzoylglycine salt
If you have any other questions or need other size, please get a quote.
Catalog Number
ACM1137608695
Product Name
4-[2-Amino-6-[(1R)-1-[4-chloro-2-(3-methyl-1H-pyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]-4-pyrimidinyl]-L-phenylalanine ethyl ester N-benzoylglycine salt
What is the molecular formula of telotristat etiprate?
The molecular formula of telotristat etiprate is C36H35ClF3N7O6.
What is the molecular weight of telotristat etiprate?
The molecular weight of telotristat etiprate is 754.2 g/mol.
What is the IUPAC name of telotristat etiprate?
The IUPAC name of telotristat etiprate is 2-benzamidoacetic acid;ethyl (2S)-2-amino-3-[4-[2-amino-6-[(1R)-1-[4-chloro-2-(3-methylpyrazol-1-yl)phenyl]-2,2,2-trifluoroethoxy]pyrimidin-4-yl]phenyl]propanoate.
What is the InChIKey of telotristat etiprate?
The InChIKey of telotristat etiprate is XSFPZBUIBYMVEA-CELUQASASA-N.
What is the canonical SMILES representation of telotristat etiprate?
The canonical SMILES representation of telotristat etiprate is CCOC(=O)C(CC1=CC=C(C=C1)C2=CC(=NC(=N2)N)OC(C3=C(C=C(C=C3)Cl)N4C=CC(=N4)C)C(F)(F)F)N.C1=CC=C(C=C1)C(=O)NCC(=O)O.
What is the CAS number of telotristat etiprate?
The CAS number of telotristat etiprate is 1137608-69-5.
How many hydrogen bond donor counts does telotristat etiprate have?
Telotristat etiprate has 4 hydrogen bond donor counts.
What is the hydrogen bond acceptor count of telotristat etiprate?
Telotristat etiprate has 14 hydrogen bond acceptor counts.
How many rotatable bond counts does telotristat etiprate have?
Telotristat etiprate has 13 rotatable bond counts.
What is the topological polar surface area of telotristat etiprate?
The topological polar surface area of telotristat etiprate is 198 Ų.
※ Please kindly note that our products are for research use only.