What is the molecular formula of the compound with the PubChem CID 67574332?
The molecular formula is C41H27N3.
When was the compound with the PubChem CID 67574332 created?
The compound was created on November 30, 2012.
What is the molecular weight of the compound with the PubChem CID 67574332?
The molecular weight is 561.7 g/mol.
What is the IUPAC name of the compound with the PubChem CID 67574332?
The IUPAC name is 9-[3-[5-(3-carbazol-9-ylphenyl)pyridin-3-yl]phenyl]carbazole.
What is the InChI key of the compound with the PubChem CID 67574332?
The InChI key is VDHOGVHFPFGPIP-UHFFFAOYSA-N.
What is the canonical SMILES of the compound with the PubChem CID 67574332?
The canonical SMILES is C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=CC(=C4)C5=CC(=CN=C5)C6=CC(=CC=C6)N7C8=CC=CC=C8C9=CC=CC=C97.
How many hydrogen bond donor count does the compound with the PubChem CID 67574332 have?
The compound has 0 hydrogen bond donor count.
How many rotatable bond count does the compound with the PubChem CID 67574332 have?
The compound has 4 rotatable bond count.
What is the topological polar surface area of the compound with the PubChem CID 67574332?
The topological polar surface area is 22.8 ?2.
Is the compound with the PubChem CID 67574332 a canonicalized compound?
Yes, the compound is canonicalized.