What is the molecular formula of 3-Sulfamoyl-benzoic acid?
The molecular formula of 3-Sulfamoyl-benzoic acid is C7H7NO4S.
What is the molecular weight of 3-Sulfamoyl-benzoic acid?
The molecular weight of 3-Sulfamoyl-benzoic acid is 201.20 g/mol.
What is the IUPAC name of 3-Sulfamoyl-benzoic acid?
The IUPAC name of 3-Sulfamoyl-benzoic acid is 3-sulfamoylbenzoic acid.
What is the Canonical SMILES representation of 3-Sulfamoyl-benzoic acid?
The Canonical SMILES representation of 3-Sulfamoyl-benzoic acid is C1=CC(=CC(=C1)S(=O)(=O)N)C(=O)O.
What is the InChIKey of 3-Sulfamoyl-benzoic acid?
The InChIKey of 3-Sulfamoyl-benzoic acid is NAETXYOXMDYNLE-UHFFFAOYSA-N.
What is the CAS number of 3-Sulfamoyl-benzoic acid?
The CAS number of 3-Sulfamoyl-benzoic acid is 636-76-0.
How many hydrogen bond donor counts are there in 3-Sulfamoyl-benzoic acid?
There are 2 hydrogen bond donor counts in 3-Sulfamoyl-benzoic acid.
How many hydrogen bond acceptor counts are there in 3-Sulfamoyl-benzoic acid?
There are 5 hydrogen bond acceptor counts in 3-Sulfamoyl-benzoic acid.
What is the topological polar surface area of 3-Sulfamoyl-benzoic acid?
The topological polar surface area of 3-Sulfamoyl-benzoic acid is 106 Ų.
Is 3-Sulfamoyl-benzoic acid considered a canonicalized compound?
Yes, 3-Sulfamoyl-benzoic acid is considered a canonicalized compound.