What is the PubChem CID of 3-quinolineboronic acid?
PubChem CID 2734663
What is the molecular formula of 3-quinolineboronic acid?
The molecular formula is C9H8BNO2.
What is the molecular weight of 3-quinolineboronic acid?
The molecular weight is 172.98 g/mol.
What is the IUPAC name of 3-quinolineboronic acid?
The IUPAC name is quinolin-3-ylboronic acid.
What is the InChI of 3-quinolineboronic acid?
The InChI is InChI=1S/C9H8BNO2/c12-10(13)8-5-7-3-1-2-4-9(7)11-6-8/h1-6,12-13H.
What is the InChIKey of 3-quinolineboronic acid?
The InChIKey is YGDICLRMNDWZAK-UHFFFAOYSA-N.
What is the canonical SMILES of 3-quinolineboronic acid?
The canonical SMILES is B(C1=CC2=CC=CC=C2N=C1)(O)O.
What is the CAS number of 3-quinolineboronic acid?
The CAS number is 191162-39-7.
What is the EC number of 3-quinolineboronic acid?
The EC number is 640-162-5.
Is 3-quinolineboronic acid a canonicalized compound?
Yes, 3-quinolineboronic acid is canonicalized.