What is the molecular formula of 3-Phenylbenzylamine?
The molecular formula of 3-Phenylbenzylamine is C13H13N.
What is the molecular weight of 3-Phenylbenzylamine?
The molecular weight of 3-Phenylbenzylamine is 183.25 g/mol.
What is the IUPAC name of 3-Phenylbenzylamine?
The IUPAC name of 3-Phenylbenzylamine is (3-phenylphenyl)methanamine.
What is the InChI of 3-Phenylbenzylamine?
The InChI of 3-Phenylbenzylamine is InChI=1S/C13H13N/c14-10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-9H,10,14H2.
What is the InChIKey of 3-Phenylbenzylamine?
The InChIKey of 3-Phenylbenzylamine is WKHABRRJMGVELW-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Phenylbenzylamine?
The canonical SMILES of 3-Phenylbenzylamine is C1=CC=C(C=C1)C2=CC=CC(=C2)CN.
What is the CAS number of 3-Phenylbenzylamine?
The CAS number of 3-Phenylbenzylamine is 177976-49-7.
What is the EC number of 3-Phenylbenzylamine?
The EC number of 3-Phenylbenzylamine is 671-211-9.
What is the XLogP3-AA value of 3-Phenylbenzylamine?
The XLogP3-AA value of 3-Phenylbenzylamine is 2.4.
Is 3-Phenylbenzylamine considered a canonicalized compound?
Yes, 3-Phenylbenzylamine is considered a canonicalized compound.