What is the molecular formula of 3-(Phenoxymethyl)aniline?
The molecular formula is C13H13NO.
What is the molecular weight of 3-(Phenoxymethyl)aniline?
The molecular weight is 199.25 g/mol.
What is the IUPAC name of 3-(Phenoxymethyl)aniline?
The IUPAC name is 3-(phenoxymethyl)aniline.
What is the InChI of 3-(Phenoxymethyl)aniline?
The InChI is InChI=1S/C13H13NO/c14-12-6-4-5-11(9-12)10-15-13-7-2-1-3-8-13/h1-9H,10,14H2.
What is the InChIKey of 3-(Phenoxymethyl)aniline?
The InChIKey is FSQPEMRQTZGIRF-UHFFFAOYSA-N.
What is the canonical SMILES of 3-(Phenoxymethyl)aniline?
The canonical SMILES is C1=CC=C(C=C1)OCC2=CC(=CC=C2)N.
What is the CAS number of 3-(Phenoxymethyl)aniline?
The CAS number is 93189-16-3.
What is the EC number of 3-(Phenoxymethyl)aniline?
The EC number is 664-155-1.
What is the XLogP3 value of 3-(Phenoxymethyl)aniline?
The XLogP3 value is 3.1.
Is 3-(Phenoxymethyl)aniline a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.