What is the PubChem CID of 3-Methylisatoic anhydride?
The PubChem CID of 3-Methylisatoic anhydride is 2759870.
What is the molecular formula of 3-Methylisatoic anhydride?
The molecular formula of 3-Methylisatoic anhydride is C9H7NO3.
What are the synonyms of 3-Methylisatoic anhydride?
The synonyms of 3-Methylisatoic anhydride include 66176-17-8, 8-methyl-1h-benzo[d][1,3]oxazine-2,4-dione, 3-methylisatoic anhydride, 3-Methyl-isatoic anhydride, and 8-methyl-2H-3,1-benzoxazine-2,4(1H)-dione.
What is the molecular weight of 3-Methylisatoic anhydride?
The molecular weight of 3-Methylisatoic anhydride is 177.16 g/mol.
What is the IUPAC name of 3-Methylisatoic anhydride?
The IUPAC name of 3-Methylisatoic anhydride is 8-methyl-1H-3,1-benzoxazine-2,4-dione.
What is the InChI of 3-Methylisatoic anhydride?
The InChI of 3-Methylisatoic anhydride is InChI=1S/C9H7NO3/c1-5-3-2-4-6-7(5)10-9(12)13-8(6)11/h2-4H,1H3,(H,10,12).
What is the InChIKey of 3-Methylisatoic anhydride?
The InChIKey of 3-Methylisatoic anhydride is CHKUQVBJPDLANA-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Methylisatoic anhydride?
The Canonical SMILES of 3-Methylisatoic anhydride is CC1=C2C(=CC=C1)C(=O)OC(=O)N2.
What is the CAS number of 3-Methylisatoic anhydride?
The CAS number of 3-Methylisatoic anhydride is 66176-17-8.
What is the EC number of 3-Methylisatoic anhydride?
The EC number of 3-Methylisatoic anhydride is 672-320-4.
※ Please kindly note that our products are for research use only.