What is the molecular formula of 3-Methylcyclobutylcarboxylic acid?
The molecular formula of 3-Methylcyclobutylcarboxylic acid is C6H10O2.
What are the synonyms for 3-Methylcyclobutylcarboxylic acid?
The synonyms for 3-Methylcyclobutylcarboxylic acid include 3-Methylcyclobutanecarboxylic acid, cis-3-Methylcyclobutanecarboxylic acid, TRANS-3-METHYLCYCLOBUTANECARBOXYLIC ACID.
What is the molecular weight of 3-Methylcyclobutylcarboxylic acid?
The molecular weight of 3-Methylcyclobutylcarboxylic acid is 114.14 g/mol.
When was 3-Methylcyclobutylcarboxylic acid created?
3-Methylcyclobutylcarboxylic acid was created on August 9, 2005.
What is the IUPAC Name of 3-Methylcyclobutylcarboxylic acid?
The IUPAC Name of 3-Methylcyclobutylcarboxylic acid is 3-methylcyclobutane-1-carboxylic acid.
What is the InChI of 3-Methylcyclobutylcarboxylic acid?
The InChI of 3-Methylcyclobutylcarboxylic acid is InChI=1S/C6H10O2/c1-4-2-5(3-4)6(7)8/h4-5H,2-3H2,1H3,(H,7,8).
What is the InChIKey of 3-Methylcyclobutylcarboxylic acid?
The InChIKey of 3-Methylcyclobutylcarboxylic acid is ZLXHOVJKNATDMT-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Methylcyclobutylcarboxylic acid?
The Canonical SMILES of 3-Methylcyclobutylcarboxylic acid is CC1CC(C1)C(=O)O.
How many hydrogen bond donor counts does 3-Methylcyclobutylcarboxylic acid have?
3-Methylcyclobutylcarboxylic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Methylcyclobutylcarboxylic acid have?
3-Methylcyclobutylcarboxylic acid has 2 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.