What is the molecular formula of 3-Methylbenzeneboronic acid, pinacol ester?
The molecular formula is C13H19BO2.
What are the synonyms of 3-Methylbenzeneboronic acid, pinacol ester?
The synonyms include 253342-48-2, 4,4,5,5-tetramethyl-2-(m-tolyl)-1,3,2-dioxaborolane, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)toluene, 3-tolylboronic acid pinacol ester, and 4,4,5,5-tetramethyl-2-(3-methylphenyl)-1,3,2-dioxaborolane.
What is the molecular weight of 3-Methylbenzeneboronic acid, pinacol ester?
The molecular weight is 218.10 g/mol.
What is the IUPAC name of 3-Methylbenzeneboronic acid, pinacol ester?
The IUPAC name is 4,4,5,5-tetramethyl-2-(3-methylphenyl)-1,3,2-dioxaborolane.
What is the InChI of 3-Methylbenzeneboronic acid, pinacol ester?
The InChI is InChI=1S/C13H19BO2/c1-10-7-6-8-11(9-10)14-15-12(2,3)13(4,5)16-14/h6-9H,1-5H3.
What is the InChIKey of 3-Methylbenzeneboronic acid, pinacol ester?
The InChIKey is XDKYCZBGHPGKEP-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methylbenzeneboronic acid, pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C.
What is the CAS number of 3-Methylbenzeneboronic acid, pinacol ester?
The CAS number is 253342-48-2.
What is the European Community (EC) number of 3-Methylbenzeneboronic acid, pinacol ester?
The European Community (EC) number is 675-045-8.
Is 3-Methylbenzeneboronic acid, pinacol ester a covalently-bonded unit?
Yes, it is a covalently-bonded unit with a count of 1.
※ Please kindly note that our products are for research use only.